5-Chloro-3-phenyl-1H-indole-2-carboxylic acid
Catalog No: FT-0680510
CAS No: 21139-31-1
- Chemical Name: 5-Chloro-3-phenyl-1H-indole-2-carboxylic acid
- Molecular Formula: C15H10ClNO2
- Molecular Weight: 271.70
- InChI Key: WQRNPWUZAVBEBC-UHFFFAOYSA-N
- InChI: InChI=1S/C15H10ClNO2/c16-10-6-7-12-11(8-10)13(14(17-12)15(18)19)9-4-2-1-3-5-9/h1-8,17H,(H,18,19)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 21139-31-1 |
| Flash_Point: | 256.6ºC |
| Product_Name: | 5-Chloro-3-phenyl-1H-indole-2-carboxylic acid |
| Bolling_Point: | 500.7ºC at 760mmHg |
| FW: | 271.69800 |
| Melting_Point: | 230-232ºC |
| MF: | C15H10ClNO2 |
| Density: | 1.417g/cm3 |
| Melting_Point: | 230-232ºC |
|---|---|
| Refractive_Index: | 1.71 |
| Vapor_Pressure: | 7.6E-11mmHg at 25°C |
| MF: | C15H10ClNO2 |
| Flash_Point: | 256.6ºC |
| LogP: | 4.18650 |
| FW: | 271.69800 |
| Density: | 1.417g/cm3 |
| PSA: | 53.09000 |
| Bolling_Point: | 500.7ºC at 760mmHg |
| Exact_Mass: | 271.04000 |
| Symbol: | GHS07 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)